CAS 913943-05-2 appears in our catalog under these names: 3-Amino-5-cyanophenylboronic acid, 98%, (3-Amino-5-cyanophenyl)boronic acid 98%, 3-AMINO-5-CYANOPHENYLBORONIC ACID, 98%, 98%, (3-Amino-5-cyanophenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 25g.
(3-amino-5-cyanophenyl)boronic acid (CAS 913943-05-2) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: (3-amino-5-cyanophenyl)boronic acid. InChIKey: QMVJJNXUBHSBIS-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | (3-amino-5-cyanophenyl)boronic acid |
| InChIKey | QMVJJNXUBHSBIS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C#N)(O)O |
Computed by PubChem (NCBI)