cas: 61700-61-6 — see every product listed under this CAS number, including other names
1H-Indazole-5-carboxylic acid 98% (CAS 61700-61-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119604-250mg |
| cas | 61700-61-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 1416.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A119604 |
1H-indazole-5-carboxylic acid (CAS 61700-61-6) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-5-carboxylic acid. InChIKey: MAVGBUDLHOOROM-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-5-carboxylic acid |
| InChIKey | MAVGBUDLHOOROM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C=NN2 |
Computed by PubChem (NCBI)