cas: 61700-61-6 — see every product listed under this CAS number, including other names
1H-Indazole-5-carboxylic acid, 98%, 98% (CAS 61700-61-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAWR-1g |
| cas | 61700-61-6 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 261.20 Pln | |
| Chemat | 100g | 736.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1H-indazole-5-carboxylic acid (CAS 61700-61-6) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-5-carboxylic acid. InChIKey: MAVGBUDLHOOROM-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-5-carboxylic acid |
| InChIKey | MAVGBUDLHOOROM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C=NN2 |
Computed by PubChem (NCBI)