cas: 1965314-73-1 — see every product listed under this CAS number, including other names
1H-Isoindole-1-carboxylic acid, 2,3-dihydro-,hydrochloride (1:1), (1S)-, 97%, 97% (CAS 1965314-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AVB-1g |
| cas | 1965314-73-1 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2512.40 Pln | |
| Chemat | 100mg | 539.60 Pln | |
| Chemat | 250mg | 822.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1S)-2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride (CAS 1965314-73-1) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (1S)-2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride. InChIKey: KPMLOVZNYPOQII-QRPNPIFTSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (1S)-2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride |
| InChIKey | KPMLOVZNYPOQII-QRPNPIFTSA-N |
| SMILES | C1C2=CC=CC=C2[C@H](N1)C(=O)O.Cl |
Computed by PubChem (NCBI)