CAS 1965314-61-7 appears in our catalog under these names: (R)-Isoindoline-1-carboxylic acid hydrochloride, 95%, (R)–Isoindoline–1–carboxylic acid hydrochloride, (R)-Isoindoline-1-carboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(1R)-2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride (CAS 1965314-61-7) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (1R)-2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride. InChIKey: KPMLOVZNYPOQII-DDWIOCJRSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (1R)-2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride |
| InChIKey | KPMLOVZNYPOQII-DDWIOCJRSA-N |
| SMILES | C1C2=CC=CC=C2[C@@H](N1)C(=O)O.Cl |
Computed by PubChem (NCBI)