Products 96016-96-5

CAS 96016-96-5 appears in our catalog under these names: 2,3-dihydro-1H-isoindole-1-carboxylic acid hydrochloride, 98%, Isoindoline-1-carboxylic acid hydrochloride 95%, 1H-Isoindole-1-carboxylic acid, 2,3-dihydro-, hydrochloride, 95%, 95%, Isoindoline-1-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride (CAS 96016-96-5) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride. InChIKey: KPMLOVZNYPOQII-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO2
Molecular weight199.63 g/mol
IUPAC name2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride
InChIKeyKPMLOVZNYPOQII-UHFFFAOYSA-N
SMILESC1C2=CC=CC=C2C(N1)C(=O)O.Cl

Computed by PubChem (NCBI)