cas: 937-27-9 — see every product listed under this CAS number, including other names
1H-Pyrrole-2,3-dicarboxylic acid 97% (CAS 937-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163689-100mg |
| cas | 937-27-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 431.56 Pln | |
| Ambeed | 5g | 1816.62 Pln | |
| Ambeed | 25g | 6772.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A163689 |
Pyrrole-2,5-dicarboxylic acid is a pyrroledicarboxylic acid in which the two carboxy groups are located at positions 2 and 5. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 1H-pyrrole-2,5-dicarboxylic acid |
| InChIKey | JLUIOEOHOOLSJC-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)