cas: 65115-91-5 — see every product listed under this CAS number, including other names
1a,9b-Dihydrooxireno[2,3-f][1,10]phenanthroline 95% (CAS 65115-91-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180425-100mg |
| cas | 65115-91-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2206.00 Pln | |
| Ambeed | 10g | 3490.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A180425 |
1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline (CAS 65115-91-5) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline. InChIKey: GGQHROHZSIPVQE-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline |
| InChIKey | GGQHROHZSIPVQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C4C2O4)N=C1 |
Computed by PubChem (NCBI)