CAS 152219-88-0 appears in our catalog under these names: 2',5'–Dimethyl–(1,1':4',1''–terphenyl)–4,4''–diamine, 2',5'-Dimethyl-[1,1':4',1''-terphenyl]-4,4''-diamine, 98%, 98%, 2',5'-Dimethyl-[1,1':4',1''-terphenyl]-4,4''-diamine, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-[4-(4-aminophenyl)-2,5-dimethylphenyl]aniline (CAS 152219-88-0) is a chemical compound with the molecular formula C20H20N2 and a molecular weight of 288.4 g/mol. IUPAC name: 4-[4-(4-aminophenyl)-2,5-dimethylphenyl]aniline. InChIKey: FZGJNYKOWLSMBQ-UHFFFAOYSA-N.
| Molecular formula | C20H20N2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-[4-(4-aminophenyl)-2,5-dimethylphenyl]aniline |
| InChIKey | FZGJNYKOWLSMBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=CC=C(C=C2)N)C)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)