CAS 1154654-11-1 is the registry number for 2,2''-Dimethyl-[1,1':4',1''-terphenyl]-4,4''-diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[4-(4-amino-2-methylphenyl)phenyl]-3-methylaniline (CAS 1154654-11-1) is a chemical compound with the molecular formula C20H20N2 and a molecular weight of 288.4 g/mol. IUPAC name: 4-[4-(4-amino-2-methylphenyl)phenyl]-3-methylaniline. InChIKey: BREFVZKQBYELLJ-UHFFFAOYSA-N.
| Molecular formula | C20H20N2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-[4-(4-amino-2-methylphenyl)phenyl]-3-methylaniline |
| InChIKey | BREFVZKQBYELLJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)C2=CC=C(C=C2)C3=C(C=C(C=C3)N)C |
Computed by PubChem (NCBI)