Products 4316-50-1

CAS 4316-50-1 is the registry number for N,N-Dimethyl-N',N'-diphenyl-1,4-phenylenediamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-N,1-N-dimethyl-4-N,4-N-diphenylbenzene-1,4-diamine (CAS 4316-50-1) is a chemical compound with the molecular formula C20H20N2 and a molecular weight of 288.4 g/mol. IUPAC name: 1-N,1-N-dimethyl-4-N,4-N-diphenylbenzene-1,4-diamine. InChIKey: TXKQCTHPSAGRJG-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20N2
Molecular weight288.4 g/mol
IUPAC name1-N,1-N-dimethyl-4-N,4-N-diphenylbenzene-1,4-diamine
InChIKeyTXKQCTHPSAGRJG-UHFFFAOYSA-N
SMILESCN(C)C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)