Products 1124218-83-2
CAS 1124218-83-2 is the registry number for 4,4'-(2,3,5,6-Tetramethyl-1,4-phenylene)dipyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,3,5,6-tetramethyl-4-pyridin-4-ylphenyl)pyridine (CAS 1124218-83-2) is a chemical compound with the molecular formula C20H20N2 and a molecular weight of 288.4 g/mol. IUPAC name: 4-(2,3,5,6-tetramethyl-4-pyridin-4-ylphenyl)pyridine. InChIKey: IYEWJYRXMGULRK-UHFFFAOYSA-N.
| Molecular formula | C20H20N2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-(2,3,5,6-tetramethyl-4-pyridin-4-ylphenyl)pyridine |
| InChIKey | IYEWJYRXMGULRK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C2=CC=NC=C2)C)C)C3=CC=NC=C3)C |
Computed by PubChem (NCBI)