Products 944268-65-9

CAS 944268-65-9 is the registry number for Demiditraz Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-benzyl-2-[1-(2,3-dimethylphenyl)ethenyl]imidazole (CAS 944268-65-9) is a chemical compound with the molecular formula C20H20N2 and a molecular weight of 288.4 g/mol. IUPAC name: 1-benzyl-2-[1-(2,3-dimethylphenyl)ethenyl]imidazole. InChIKey: FLNARDXUDGDFBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20N2
Molecular weight288.4 g/mol
IUPAC name1-benzyl-2-[1-(2,3-dimethylphenyl)ethenyl]imidazole
InChIKeyFLNARDXUDGDFBQ-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C(=C)C2=NC=CN2CC3=CC=CC=C3)C

Computed by PubChem (NCBI)