CAS 944268-65-9 is the registry number for Demiditraz Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-benzyl-2-[1-(2,3-dimethylphenyl)ethenyl]imidazole (CAS 944268-65-9) is a chemical compound with the molecular formula C20H20N2 and a molecular weight of 288.4 g/mol. IUPAC name: 1-benzyl-2-[1-(2,3-dimethylphenyl)ethenyl]imidazole. InChIKey: FLNARDXUDGDFBQ-UHFFFAOYSA-N.
| Molecular formula | C20H20N2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 1-benzyl-2-[1-(2,3-dimethylphenyl)ethenyl]imidazole |
| InChIKey | FLNARDXUDGDFBQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=C)C2=NC=CN2CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)