CAS 134532-03-9 appears in our catalog under these names: 2'-Amino-[1,1'-binaphthalen]-2-ol, 97%, 97%, 2'-Amino[1,1'-binaphthalen]-2-ol, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(2-aminonaphthalen-1-yl)naphthalen-2-ol (CAS 134532-03-9) is a chemical compound with the molecular formula C20H15NO and a molecular weight of 285.3 g/mol. IUPAC name: 1-(2-aminonaphthalen-1-yl)naphthalen-2-ol. InChIKey: HIXQCPGXQVQHJP-UHFFFAOYSA-N.
| Molecular formula | C20H15NO |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 1-(2-aminonaphthalen-1-yl)naphthalen-2-ol |
| InChIKey | HIXQCPGXQVQHJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)O)N |
Computed by PubChem (NCBI)