CAS 893736-83-9 is the registry number for 3-[4-(Benzyloxy)phenyl]benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(4-phenylmethoxyphenyl)benzonitrile (CAS 893736-83-9) is a chemical compound with the molecular formula C20H15NO and a molecular weight of 285.3 g/mol. IUPAC name: 3-(4-phenylmethoxyphenyl)benzonitrile. InChIKey: KSEFXTUDRJYZAY-UHFFFAOYSA-N.
| Molecular formula | C20H15NO |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 3-(4-phenylmethoxyphenyl)benzonitrile |
| InChIKey | KSEFXTUDRJYZAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C3=CC=CC(=C3)C#N |
Computed by PubChem (NCBI)