CAS 137848-28-3 appears in our catalog under these names: (R)-NOBIN, 97%, (R)–(+)–2–Amino–2'–hydroxy–1,1'–binaphthyl, (R)-(+)-2-Amino-2'-hydroxy-1,1'-binaphthyl, >98.0%(HPLC), (R)-(+)-2'-AMINO-1,1'-BINAPHTHALEN-2-OL, (R)-2-Amino-2'-hydroxy-1,1'-binaphthyl, 98%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
1-(2-aminonaphthalen-1-yl)naphthalen-2-ol (CAS 137848-28-3) is a chemical compound with the molecular formula C20H15NO and a molecular weight of 285.3 g/mol. IUPAC name: 1-(2-aminonaphthalen-1-yl)naphthalen-2-ol. InChIKey: HIXQCPGXQVQHJP-UHFFFAOYSA-N.
| Molecular formula | C20H15NO |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 1-(2-aminonaphthalen-1-yl)naphthalen-2-ol |
| InChIKey | HIXQCPGXQVQHJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)O)N |
Computed by PubChem (NCBI)