CAS 151409-77-7 is the registry number for 1-(1-Naphthylmethyl)indole-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
1-(naphthalen-1-ylmethyl)indole-3-carbaldehyde (CAS 151409-77-7) is a chemical compound with the molecular formula C20H15NO and a molecular weight of 285.3 g/mol. IUPAC name: 1-(naphthalen-1-ylmethyl)indole-3-carbaldehyde. InChIKey: IJIPHJOFFJPRLX-UHFFFAOYSA-N.
| Molecular formula | C20H15NO |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 1-(naphthalen-1-ylmethyl)indole-3-carbaldehyde |
| InChIKey | IJIPHJOFFJPRLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CN3C=C(C4=CC=CC=C43)C=O |
Computed by PubChem (NCBI)