CAS 137848-29-4 appears in our catalog under these names: (S)–(–)–2–Amino–2'–hydroxy–1,1'–binaphthyl, (S)-(-)-2-Amino-2'-hydroxy-1,1'-binaphthyl, >98.0%(HPLC), (S)-(-)-2-Amino-2'-hydroxy-1,1'-binaphthyl, 95%, (S)-NOBIN 98%, (S)-(-)-2'-AMINO-1,1'-BINAPHTHALEN-2-OL. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 500mg, 5g, 250MG, 1g.
1-(2-aminonaphthalen-1-yl)naphthalen-2-ol (CAS 137848-29-4) is a chemical compound with the molecular formula C20H15NO and a molecular weight of 285.3 g/mol. IUPAC name: 1-(2-aminonaphthalen-1-yl)naphthalen-2-ol. InChIKey: HIXQCPGXQVQHJP-UHFFFAOYSA-N.
| Molecular formula | C20H15NO |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 1-(2-aminonaphthalen-1-yl)naphthalen-2-ol |
| InChIKey | HIXQCPGXQVQHJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)O)N |
Computed by PubChem (NCBI)