CAS 15397-12-3 appears in our catalog under these names: 2'-C-Methyladenosine, 98%, 2'-C-Methyladenosine/ 98.31% (existing batch purity), 2'–C–Methyladenosine, 2'-C-Methyladenosine 98%, (2R,3R,4R,5R)-2-(6-Amino-9H-purin-9-yl)-5-(hydroxymethyl)-3-methyltetrahydrofuran-3,4-diol, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (CAS 15397-12-3) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol. InChIKey: PASOFFRBGIVJET-YRKGHMEHSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| InChIKey | PASOFFRBGIVJET-YRKGHMEHSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)O)O |
Computed by PubChem (NCBI)