cas: 399-35-9 — see every product listed under this CAS number, including other names
2'-Chloro-4'-fluoroacetanilide, >98.0%(GC) (CAS 399-35-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1311-5G |
| cas | 399-35-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 172.43 Pln | |
| TCI | 25g | 614.99 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
N-(2-chloro-4-fluorophenyl)acetamide (CAS 399-35-9) is a chemical compound with the molecular formula C8H7ClFNO and a molecular weight of 187.60 g/mol. IUPAC name: N-(2-chloro-4-fluorophenyl)acetamide. InChIKey: ZULZFLOGABTQFR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO |
|---|---|
| Molecular weight | 187.60 g/mol |
| IUPAC name | N-(2-chloro-4-fluorophenyl)acetamide |
| InChIKey | ZULZFLOGABTQFR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)F)Cl |
Computed by PubChem (NCBI)