cas: 399-35-9 — see every product listed under this CAS number, including other names
N-(2-Chloro-4-fluorophenyl)acetamide, 98% (CAS 399-35-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633475-25G |
| cas | 399-35-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 263.47 Pln | |
| Fluorochem | 100g | 846.59 Pln | |
| Fluorochem | 500g | 4001.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(2-chloro-4-fluorophenyl)acetamide (CAS 399-35-9) is a chemical compound with the molecular formula C8H7ClFNO and a molecular weight of 187.60 g/mol. IUPAC name: N-(2-chloro-4-fluorophenyl)acetamide. InChIKey: ZULZFLOGABTQFR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO |
|---|---|
| Molecular weight | 187.60 g/mol |
| IUPAC name | N-(2-chloro-4-fluorophenyl)acetamide |
| InChIKey | ZULZFLOGABTQFR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)F)Cl |
Computed by PubChem (NCBI)