cas: 39802-78-3 — see every product listed under this CAS number, including other names
2'-Chloro-biphenyl-4-carbaldehyde (CAS 39802-78-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032295-250MG |
| cas | 39802-78-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 2325.24 Pln |
| delivery time | 3-4 weeks |
|---|
4-(2-chlorophenyl)benzaldehyde (CAS 39802-78-3) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 4-(2-chlorophenyl)benzaldehyde. InChIKey: PGMYZSDMJRFWKS-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 4-(2-chlorophenyl)benzaldehyde |
| InChIKey | PGMYZSDMJRFWKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C=O)Cl |
Computed by PubChem (NCBI)