CAS 223575-76-6 appears in our catalog under these names: 2'-Chloro-biphenyl-2-carbaldehyde, 95%, 2'-Chloro(1,1'-biphenyl)-2-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
2-(2-chlorophenyl)benzaldehyde (CAS 223575-76-6) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 2-(2-chlorophenyl)benzaldehyde. InChIKey: VNKJIEIGSAHDGE-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2-(2-chlorophenyl)benzaldehyde |
| InChIKey | VNKJIEIGSAHDGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)