CAS 14002-51-8 appears in our catalog under these names: 4-Biphenylcarbonyl chloride, 97%, 4-Phenylbenzoyl chloride, 98%, 4–Phenylbenzoyl Chloride, Biphenyl-4-carbonyl chloride, 98% , 4-Phenylbenzoyl chloride. Offered by: Combi-blocks, Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 25g, 500g, 5g, on request, 10g, 50g, 0,025kg.
4-phenylbenzoyl chloride (CAS 14002-51-8) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 4-phenylbenzoyl chloride. InChIKey: JPVUWCPKMYXOKW-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 4-phenylbenzoyl chloride |
| InChIKey | JPVUWCPKMYXOKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)