CAS 216443-25-3 appears in our catalog under these names: 3'-Chlorobiphenyl-2-carbaldehyde, 95%, 3'-Chloro-(1,1'-biphenyl)-2-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(3-chlorophenyl)benzaldehyde (CAS 216443-25-3) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 2-(3-chlorophenyl)benzaldehyde. InChIKey: QPYBBMYVPFPRHE-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2-(3-chlorophenyl)benzaldehyde |
| InChIKey | QPYBBMYVPFPRHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)