CAS 42498-44-2 is the registry number for Biphenyl-3-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-phenylbenzoyl chloride (CAS 42498-44-2) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 3-phenylbenzoyl chloride. InChIKey: FJAFGSULCGOKPU-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 3-phenylbenzoyl chloride |
| InChIKey | FJAFGSULCGOKPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)