cas: 22107-30-8 — see every product listed under this CAS number, including other names
2'-Hydroxyacetophenone semicarbazone, 98%, 98% (CAS 22107-30-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118PLQ-250mg |
| cas | 22107-30-8 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 818.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(E)-1-(2-hydroxyphenyl)ethylideneamino]urea (CAS 22107-30-8) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: [(E)-1-(2-hydroxyphenyl)ethylideneamino]urea. InChIKey: SLSXRIZAOSGASD-IZZDOVSWSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | [(E)-1-(2-hydroxyphenyl)ethylideneamino]urea |
| InChIKey | SLSXRIZAOSGASD-IZZDOVSWSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC=CC=C1O |
Computed by PubChem (NCBI)