cas: 22107-30-8 — see every product listed under this CAS number, including other names
2-(1-(2-Hydroxyphenyl)ethylidene)hydrazinecarboxamide 98% (CAS 22107-30-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A740701-250mg |
| cas | 22107-30-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 832.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A740701 |
[(E)-1-(2-hydroxyphenyl)ethylideneamino]urea (CAS 22107-30-8) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: [(E)-1-(2-hydroxyphenyl)ethylideneamino]urea. InChIKey: SLSXRIZAOSGASD-IZZDOVSWSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | [(E)-1-(2-hydroxyphenyl)ethylideneamino]urea |
| InChIKey | SLSXRIZAOSGASD-IZZDOVSWSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC=CC=C1O |
Computed by PubChem (NCBI)