cas: 5672-94-6 — see every product listed under this CAS number, including other names
2'-Methoxy-1'-acetonaphthone, >98.0%(GC) (CAS 5672-94-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2875-1G |
| cas | 5672-94-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 354.37 Pln | |
| TCI | 5g | 1136.22 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-(2-methoxynaphthalen-1-yl)ethanone (CAS 5672-94-6) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 1-(2-methoxynaphthalen-1-yl)ethanone. InChIKey: WFBBDKXOGOJOKY-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 1-(2-methoxynaphthalen-1-yl)ethanone |
| InChIKey | WFBBDKXOGOJOKY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC2=CC=CC=C21)OC |
Computed by PubChem (NCBI)