Products 91902-58-8
CAS 91902-58-8 appears in our catalog under these names: 4-Ethyl-1-naphthoic acid, 95%, 4-Ethyl-1-naphthoic Acid, 4–Ethyl–1–naphthoic acid, 4-Ethyl-1-naphthoic acid 95%, 4-Ethyl-1-naphthoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 2,5g, 500mg, 25g, 250mg, 100g.
4-ethylnaphthalene-1-carboxylic acid (CAS 91902-58-8) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 4-ethylnaphthalene-1-carboxylic acid. InChIKey: PLFCGQDMWZGHOQ-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 4-ethylnaphthalene-1-carboxylic acid |
| InChIKey | PLFCGQDMWZGHOQ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C2=CC=CC=C12)C(=O)O |
Computed by PubChem (NCBI)