CAS 757230-55-0 appears in our catalog under these names: 6-Ethoxy-2-naphthaldehyde, 95%, 6–Ethoxy–2–naphthaldehyde, 6-Ethoxy-2-naphthaldehyde. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
6-ethoxynaphthalene-2-carbaldehyde (CAS 757230-55-0) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 6-ethoxynaphthalene-2-carbaldehyde. InChIKey: OSGZDTOUNPFJEP-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 6-ethoxynaphthalene-2-carbaldehyde |
| InChIKey | OSGZDTOUNPFJEP-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C=C(C=C2)C=O |
Computed by PubChem (NCBI)