CAS 5672-94-6 appears in our catalog under these names: 2'-Methoxy-1'-acetonaphthone, 98%, 2'–Methoxy–1'–acetonaphthone, 2'-Methoxy-1'-acetonaphthone, >98.0%(GC), 1-(2-Methoxynaphthalen-1-yl)ethanone 97%, 1-(2-Methoxynaphthalen-1-Yl)Ethanone, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 200mg, 250mg, 100mg, 10g, 25g.
1-(2-methoxynaphthalen-1-yl)ethanone (CAS 5672-94-6) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 1-(2-methoxynaphthalen-1-yl)ethanone. InChIKey: WFBBDKXOGOJOKY-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 1-(2-methoxynaphthalen-1-yl)ethanone |
| InChIKey | WFBBDKXOGOJOKY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC2=CC=CC=C21)OC |
Computed by PubChem (NCBI)