Products 3117-51-9
CAS 3117-51-9 appears in our catalog under these names: 2-(Naphthalen-1-yl)propanoic acid, 95%, a-Methyl-1-naphthaleneacetic acid, 95%, a-methyl-1-naphthaleneacetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
2-naphthalen-1-ylpropanoic acid (CAS 3117-51-9) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2-naphthalen-1-ylpropanoic acid. InChIKey: VKCNNDPZFOVURD-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-naphthalen-1-ylpropanoic acid |
| InChIKey | VKCNNDPZFOVURD-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(naphthalen-1-yl)propanoic acid, 2-(1-naphthyl)propionic acid, alpha-Methyl-1-naphthaleneacetic acid, a-Methyl-1-naphthaleneacetic acid, 2-(1-Naphthyl)propanoic acid, 2-naphthalen-1-ylpropanoic acid, beta-Methyl-1-naphthaleneethanol;, 2-Naphthylpropionic acid, naphthylpropionic acid, 1-Naphthaleneacetic acid, alpha-methyl-