cas: 94-93-9 — see every product listed under this CAS number, including other names
2,2'-((Ethane-1,2-diylbis(azanylylidene))bis(methanylylidene))diphenol, 98%, 98% (CAS 94-93-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117QVF-5g |
| cas | 94-93-9 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 500g | 432.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol (CAS 94-93-9) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol. InChIKey: VEUMANXWQDHAJV-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
| InChIKey | VEUMANXWQDHAJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NCCN=CC2=CC=CC=C2O)O |
Computed by PubChem (NCBI)