CAS 1226-43-3 is the registry number for N'-Benzoyl-n,n'-dimethylbenzohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-benzoyl-N,N'-dimethylbenzohydrazide (CAS 1226-43-3) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: N'-benzoyl-N,N'-dimethylbenzohydrazide. InChIKey: PQEZHJRKUSZEBK-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | N'-benzoyl-N,N'-dimethylbenzohydrazide |
| InChIKey | PQEZHJRKUSZEBK-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC=CC=C1)N(C)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)