CAS 241488-20-0 is the registry number for 1-(4-[(2E)-3-(Dimethylamino)prop-2-enoyl]phenyl)-1,4-dihydropyridin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[4-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]pyridin-4-one (CAS 241488-20-0) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: 1-[4-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]pyridin-4-one. InChIKey: QHSRAEDOBBFUSX-MDZDMXLPSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 1-[4-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]pyridin-4-one |
| InChIKey | QHSRAEDOBBFUSX-MDZDMXLPSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC=C(C=C1)N2C=CC(=O)C=C2 |
Computed by PubChem (NCBI)