CAS 1530-73-0 appears in our catalog under these names: N,N'-Bis(p-toluoyl)hydrazine, 95%, N,N'-Bis(p-toluoyl)hydrazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 2g, 10g.
4-methyl-N'-(4-methylbenzoyl)benzohydrazide (CAS 1530-73-0) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: 4-methyl-N'-(4-methylbenzoyl)benzohydrazide. InChIKey: SWVLEZBOJRWRJB-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 4-methyl-N'-(4-methylbenzoyl)benzohydrazide |
| InChIKey | SWVLEZBOJRWRJB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)NNC(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)