CAS 72150-35-7 appears in our catalog under these names: Bz-phe-nh2, 98%, (S)-N-(1-Amino-1-oxo-3-phenylpropan-2-yl)benzamide, 97%, Bz–L–Phe–NH2, Bz-Phe-NH2, 97%(HPLC),RG, 97%(HPLC),RG. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]benzamide (CAS 72150-35-7) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]benzamide. InChIKey: GDJKEUNPXYLPHG-AWEZNQCLSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]benzamide |
| InChIKey | GDJKEUNPXYLPHG-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)