cas: 10038-40-1 — see every product listed under this CAS number, including other names
2,2'-Bis(hydroxymethyl)diphenyl Ether (CAS 10038-40-1) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112UD-200mg |
| cas | 10038-40-1 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 194.00 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1509.20 Pln |
| delivery time | 3 weeks |
|---|
[2-[2-(hydroxymethyl)phenoxy]phenyl]methanol (CAS 10038-40-1) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: [2-[2-(hydroxymethyl)phenoxy]phenyl]methanol. InChIKey: VRVKKKKXKVCPEW-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | [2-[2-(hydroxymethyl)phenoxy]phenyl]methanol |
| InChIKey | VRVKKKKXKVCPEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)OC2=CC=CC=C2CO |
Computed by PubChem (NCBI)