CAS 41738-72-1 appears in our catalog under these names: 2,2'-Dihydroxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%, 97%, 2,2'-Dihydroxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-(4-carboxy-2-hydroxyphenyl)-3-hydroxybenzoic acid (CAS 41738-72-1) is a chemical compound with the molecular formula C14H10O6 and a molecular weight of 274.22 g/mol. IUPAC name: 4-(4-carboxy-2-hydroxyphenyl)-3-hydroxybenzoic acid. InChIKey: CVWDKBHAUIZWAY-UHFFFAOYSA-N.
| Molecular formula | C14H10O6 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | 4-(4-carboxy-2-hydroxyphenyl)-3-hydroxybenzoic acid |
| InChIKey | CVWDKBHAUIZWAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)C2=C(C=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)