Products 211948-69-5
CAS 211948-69-5 appears in our catalog under these names: 1，3，7–Trihydroxy–2–methoxyxanthone, 1,3,7-Trihydroxy-2-methoxyxanthone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
1,3,7-trihydroxy-2-methoxyxanthen-9-one (CAS 211948-69-5) is a chemical compound with the molecular formula C14H10O6 and a molecular weight of 274.22 g/mol. IUPAC name: 1,3,7-trihydroxy-2-methoxyxanthen-9-one. InChIKey: GLXRAYJUKLGHEP-UHFFFAOYSA-N.
| Molecular formula | C14H10O6 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | 1,3,7-trihydroxy-2-methoxyxanthen-9-one |
| InChIKey | GLXRAYJUKLGHEP-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1O)OC3=C(C2=O)C=C(C=C3)O)O |
Computed by PubChem (NCBI)