CAS 861533-46-2 appears in our catalog under these names: 3,3'-Dihydroxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%, 3,3'–Dihydroxy–(1,1'–biphenyl)–4,4'–dicarboxylic acid, 3, 3'- Dihydroxy- (1, 1'- biphenyl) - 4, 4'- dicarboxylic acid, 3,3'-Dihydroxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid 97%, 3,3'-Dihydroxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 25mg, 50mg, 10g, 5g.
4-(4-carboxy-3-hydroxyphenyl)-2-hydroxybenzoic acid (CAS 861533-46-2) is a chemical compound with the molecular formula C14H10O6 and a molecular weight of 274.22 g/mol. IUPAC name: 4-(4-carboxy-3-hydroxyphenyl)-2-hydroxybenzoic acid. InChIKey: HVMTVUVEDJACFQ-UHFFFAOYSA-N.
| Molecular formula | C14H10O6 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | 4-(4-carboxy-3-hydroxyphenyl)-2-hydroxybenzoic acid |
| InChIKey | HVMTVUVEDJACFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)C(=O)O)O)O)C(=O)O |
Computed by PubChem (NCBI)