CAS 27822-80-6 is the registry number for 4,4'-Dihydroxy-[1,1'-biphenyl]-2,2'-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-carboxy-4-hydroxyphenyl)-5-hydroxybenzoic acid (CAS 27822-80-6) is a chemical compound with the molecular formula C14H10O6 and a molecular weight of 274.22 g/mol. IUPAC name: 2-(2-carboxy-4-hydroxyphenyl)-5-hydroxybenzoic acid. InChIKey: JDGZONSWIMFPDO-UHFFFAOYSA-N.
| Molecular formula | C14H10O6 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | 2-(2-carboxy-4-hydroxyphenyl)-5-hydroxybenzoic acid |
| InChIKey | JDGZONSWIMFPDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(=O)O)C2=C(C=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)