Products 27822-80-6

CAS 27822-80-6 is the registry number for 4,4'-Dihydroxy-[1,1'-biphenyl]-2,2'-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-carboxy-4-hydroxyphenyl)-5-hydroxybenzoic acid (CAS 27822-80-6) is a chemical compound with the molecular formula C14H10O6 and a molecular weight of 274.22 g/mol. IUPAC name: 2-(2-carboxy-4-hydroxyphenyl)-5-hydroxybenzoic acid. InChIKey: JDGZONSWIMFPDO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10O6
Molecular weight274.22 g/mol
IUPAC name2-(2-carboxy-4-hydroxyphenyl)-5-hydroxybenzoic acid
InChIKeyJDGZONSWIMFPDO-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1O)C(=O)O)C2=C(C=C(C=C2)O)C(=O)O

Computed by PubChem (NCBI)