CAS 50868-52-5 appears in our catalog under these names: 1,5,6–Trihydroxy–3–methoxyxanthone, 1,5,6-Trihydroxy-3-methoxyxanthone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
1,5,6-trihydroxy-3-methoxyxanthen-9-one (CAS 50868-52-5) is a chemical compound with the molecular formula C14H10O6 and a molecular weight of 274.22 g/mol. IUPAC name: 1,5,6-trihydroxy-3-methoxyxanthen-9-one. InChIKey: JHOYIGDPCIBYKV-UHFFFAOYSA-N.
| Molecular formula | C14H10O6 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | 1,5,6-trihydroxy-3-methoxyxanthen-9-one |
| InChIKey | JHOYIGDPCIBYKV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC3=C(C2=O)C=CC(=C3O)O)O |
Computed by PubChem (NCBI)