Products 117490-51-4
CAS 117490-51-4 appears in our catalog under these names: 2，2'-Dimethyl-[1，1'-biphenyl]-4，4'-dicarbonitrile, 98%, 98%, 2,2'-Dimethyl-[1,1'-biphenyl]-4,4'-dicarbonitrile, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(4-cyano-2-methylphenyl)-3-methylbenzonitrile (CAS 117490-51-4) is a chemical compound with the molecular formula C16H12N2 and a molecular weight of 232.28 g/mol. IUPAC name: 4-(4-cyano-2-methylphenyl)-3-methylbenzonitrile. InChIKey: MLBIEVOGQRJCIV-UHFFFAOYSA-N.
| Molecular formula | C16H12N2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 4-(4-cyano-2-methylphenyl)-3-methylbenzonitrile |
| InChIKey | MLBIEVOGQRJCIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C#N)C2=C(C=C(C=C2)C#N)C |
Computed by PubChem (NCBI)