CAS 27393-85-7 is the registry number for 1H,1'H-2,3'-Biindole, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1H-indol-3-yl)-1H-indole (CAS 27393-85-7) is a chemical compound with the molecular formula C16H12N2 and a molecular weight of 232.28 g/mol. IUPAC name: 2-(1H-indol-3-yl)-1H-indole. InChIKey: KWGGLCJWTVNIAO-UHFFFAOYSA-N.
| Molecular formula | C16H12N2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-1H-indole |
| InChIKey | KWGGLCJWTVNIAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)