CAS 14923-84-3 appears in our catalog under these names: 1,6-Diaminopyrene, 95%, 1,6-Pyrenediamine, >95% (HPLC), 1,6-Diaminopyrene, >98.0%(N), Pyrene-1,6-diamine, 98%, 98%, 1,6-DIAMINOPYRENE, 96%. Offered by: Combi-blocks, TRC, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 10mg, 500mg, 50mg, 1g, 25mg.
Pyrene-1,6-diamine (CAS 14923-84-3) is a chemical compound with the molecular formula C16H12N2 and a molecular weight of 232.28 g/mol. IUPAC name: pyrene-1,6-diamine. InChIKey: OWJJRQSAIMYXQJ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | pyrene-1,6-diamine |
| InChIKey | OWJJRQSAIMYXQJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C4=C1C=CC(=C4C=C3)N)N |
Computed by PubChem (NCBI)