CAS 30269-04-6 appears in our catalog under these names: 1,8-Diaminopyrene, 95%, 1,8-Pyrenediamine, >95% (HPLC), 1,8–Diaminopyrene, Pyrene-1,8-diamine, 1,8-DIAMINOPYRENE, >97.0%(HPLC). Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg.
Pyrene-1,8-diamine (CAS 30269-04-6) is a chemical compound with the molecular formula C16H12N2 and a molecular weight of 232.28 g/mol. IUPAC name: pyrene-1,8-diamine. InChIKey: BLYOXQBERINFDU-UHFFFAOYSA-N.
| Molecular formula | C16H12N2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | pyrene-1,8-diamine |
| InChIKey | BLYOXQBERINFDU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C(C=C2)N)C=CC4=C(C=CC1=C43)N |
Computed by PubChem (NCBI)