CAS 92821-64-2 appears in our catalog under these names: 1,3-Diaminopyrene, 95%, 1,3-Pyrenediamine, 1,3–Diaminopyrene, 1,3-Diaminopyrene, >98.0%(HPLC). Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 10mg.
Pyrene-1,3-diamine (CAS 92821-64-2) is a chemical compound with the molecular formula C16H12N2 and a molecular weight of 232.28 g/mol. IUPAC name: pyrene-1,3-diamine. InChIKey: WOFKFNZIJZWWPZ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | pyrene-1,3-diamine |
| InChIKey | WOFKFNZIJZWWPZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=C(C(=C43)C=C2)N)N |
Computed by PubChem (NCBI)