cas: 245487-45-0 — see every product listed under this CAS number, including other names
2,2,2-TRIFLUORO-1-(PIPERAZIN-1-YL)ETHANONE HCL, 95% (CAS 245487-45-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F469500-250MG |
| cas | 245487-45-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 500mg | 268.67 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 2.5g | 888.25 Pln | |
| Fluorochem | 5g | 1309.97 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,2,2-trifluoro-1-piperazin-1-ylethanone;hydrochloride (CAS 245487-45-0) is a chemical compound with the molecular formula C6H10ClF3N2O and a molecular weight of 218.60 g/mol. IUPAC name: 2,2,2-trifluoro-1-piperazin-1-ylethanone;hydrochloride. InChIKey: JLIKRYCMRPFILF-UHFFFAOYSA-N.
| Molecular formula | C6H10ClF3N2O |
|---|---|
| Molecular weight | 218.60 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-piperazin-1-ylethanone;hydrochloride |
| InChIKey | JLIKRYCMRPFILF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)